C14H15ClF3N — CID 10902335
(Z)-3-chloro-4,4,4-trifluoro-N-(2-methylpropyl)-2-phenylbut-2-en-1-imine (PubChem CID 10902335) has the molecular formula C14H15ClF3N and a molecular weight of 289.73 g/mol. Its IUPAC name is (Z)-3-chloro-4,4,4-trifluoro-N-(2-methylpropyl)-2-phenylbut-2-en-1-imine.
| Compound Name | (Z)-3-chloro-4,4,4-trifluoro-N-(2-methylpropyl)-2-phenylbut-2-en-1-imine |
|---|---|
| PubChem CID | 10902335 |
| Molecular Formula | C14H15ClF3N |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (Z)-3-chloro-4,4,4-trifluoro-N-(2-methylpropyl)-2-phenylbut-2-en-1-imine |
| SMILES | CC(C)C/N=C/C(=C(\Cl)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H15ClF3N/c1-10(2)8-19-9-12(13(15)14(16,17)18)11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3/b13-12+,19-9+ |
| InChIKey | WTUKKMSVQBUMNS-DFMKLQABSA-N |
| XLogP | 4.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|