C12H13ClF3N — CID 170891137
(Z)-5-chloro-6,6,6-trifluoro-4-phenylhex-4-en-2-amine (PubChem CID 170891137) has the molecular formula C12H13ClF3N and a molecular weight of 263.69 g/mol. Its IUPAC name is (Z)-5-chloro-6,6,6-trifluoro-4-phenylhex-4-en-2-amine.
| Compound Name | (Z)-5-chloro-6,6,6-trifluoro-4-phenylhex-4-en-2-amine |
|---|---|
| PubChem CID | 170891137 |
| Molecular Formula | C12H13ClF3N |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | (Z)-5-chloro-6,6,6-trifluoro-4-phenylhex-4-en-2-amine |
| SMILES | CC(N)C/C(=C(/Cl)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H13ClF3N/c1-8(17)7-10(11(13)12(14,15)16)9-5-3-2-4-6-9/h2-6,8H,7,17H2,1H3/b11-10- |
| InChIKey | WVRGLNNUSAUGNE-KHPPLWFESA-N |
| XLogP | 3.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |