C19H22I2Si — CID 23650015
[(E)-1,4-diiodo-3,4-diphenylbut-3-enyl]-trimethylsilane (PubChem CID 23650015) has the molecular formula C19H22I2Si and a molecular weight of 532.28 g/mol. Its IUPAC name is [(E)-1,4-diiodo-3,4-diphenylbut-3-enyl]-trimethylsilane.
| Compound Name | [(E)-1,4-diiodo-3,4-diphenylbut-3-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 23650015 |
| Molecular Formula | C19H22I2Si |
| Molecular Weight | 532.28 g/mol |
| Exact Mass | 531.96 |
| IUPAC Name | [(E)-1,4-diiodo-3,4-diphenylbut-3-enyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(I)C/C(=C(\I)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22I2Si/c1-22(2,3)18(20)14-17(15-10-6-4-7-11-15)19(21)16-12-8-5-9-13-16/h4-13,18H,14H2,1-3H3/b19-17+ |
| InChIKey | GPRMKKXXSOPMKT-HTXNQAPBSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.28 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|