C18H19IO — CID 134884562
(Z)-1-iodo-1,2-diphenylhex-1-en-3-ol (PubChem CID 134884562) has the molecular formula C18H19IO and a molecular weight of 378.25 g/mol. Its IUPAC name is (Z)-1-iodo-1,2-diphenylhex-1-en-3-ol.
| Compound Name | (Z)-1-iodo-1,2-diphenylhex-1-en-3-ol |
|---|---|
| PubChem CID | 134884562 |
| Molecular Formula | C18H19IO |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | (Z)-1-iodo-1,2-diphenylhex-1-en-3-ol |
| SMILES | CCCC(O)/C(=C(\I)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19IO/c1-2-9-16(20)17(14-10-5-3-6-11-14)18(19)15-12-7-4-8-13-15/h3-8,10-13,16,20H,2,9H2,1H3/b18-17- |
| InChIKey | MZTQKSDCHYTMNR-ZCXUNETKSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|