C17H20O — CID 102474717
(1R,2R)-1,2-diphenylpentan-1-ol (PubChem CID 102474717) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is (1R,2R)-1,2-diphenylpentan-1-ol.
| Compound Name | (1R,2R)-1,2-diphenylpentan-1-ol |
|---|---|
| PubChem CID | 102474717 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (1R,2R)-1,2-diphenylpentan-1-ol |
| SMILES | CCC[C@H](c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H20O/c1-2-9-16(14-10-5-3-6-11-14)17(18)15-12-7-4-8-13-15/h3-8,10-13,16-18H,2,9H2,1H3/t16-,17+/m1/s1 |
| InChIKey | DNJKGOZCTUTFEJ-SJORKVTESA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |