C18H24OSi — CID 124629266
(1R,2R)-1,2-diphenyl-3-trimethylsilylpropan-1-ol (PubChem CID 124629266) has the molecular formula C18H24OSi and a molecular weight of 284.48 g/mol. Its IUPAC name is (1R,2R)-1,2-diphenyl-3-trimethylsilylpropan-1-ol.
| Compound Name | (1R,2R)-1,2-diphenyl-3-trimethylsilylpropan-1-ol |
|---|---|
| PubChem CID | 124629266 |
| Molecular Formula | C18H24OSi |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1R,2R)-1,2-diphenyl-3-trimethylsilylpropan-1-ol |
| SMILES | C[Si](C)(C)C[C@H](c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H24OSi/c1-20(2,3)14-17(15-10-6-4-7-11-15)18(19)16-12-8-5-9-13-16/h4-13,17-19H,14H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | QOQLYXJRUDNSAM-MSOLQXFVSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|