C15H24OSi — CID 102275587
(E,1S,2R)-2-methyl-1-phenyl-5-trimethylsilylpent-3-en-1-ol (PubChem CID 102275587) has the molecular formula C15H24OSi and a molecular weight of 248.44 g/mol. Its IUPAC name is (E,1S,2R)-2-methyl-1-phenyl-5-trimethylsilylpent-3-en-1-ol.
| Compound Name | (E,1S,2R)-2-methyl-1-phenyl-5-trimethylsilylpent-3-en-1-ol |
|---|---|
| PubChem CID | 102275587 |
| Molecular Formula | C15H24OSi |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (E,1S,2R)-2-methyl-1-phenyl-5-trimethylsilylpent-3-en-1-ol |
| SMILES | C[C@H](/C=C/C[Si](C)(C)C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H24OSi/c1-13(9-8-12-17(2,3)4)15(16)14-10-6-5-7-11-14/h5-11,13,15-16H,12H2,1-4H3/b9-8+/t13-,15+/m1/s1 |
| InChIKey | FZYRLBXBDBQGBE-HOMMJUPQSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|