C15H22OSi — CID 101067256
(2S)-2-methyl-1-phenyl-5-trimethylsilylpenta-3,4-dien-1-ol (PubChem CID 101067256) has the molecular formula C15H22OSi and a molecular weight of 246.43 g/mol. Its IUPAC name is (2S)-2-methyl-1-phenyl-5-trimethylsilylpenta-3,4-dien-1-ol.
| Compound Name | (2S)-2-methyl-1-phenyl-5-trimethylsilylpenta-3,4-dien-1-ol |
|---|---|
| PubChem CID | 101067256 |
| Molecular Formula | C15H22OSi |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (2S)-2-methyl-1-phenyl-5-trimethylsilylpenta-3,4-dien-1-ol |
| SMILES | C[C@@H](C=C=C[Si](C)(C)C)C(O)c1ccccc1 |
| InChI | InChI=1S/C15H22OSi/c1-13(9-8-12-17(2,3)4)15(16)14-10-6-5-7-11-14/h5-7,9-13,15-16H,1-4H3/t8?,13-,15?/m0/s1 |
| InChIKey | ZQHRAOXVIVLLLH-KYAFNEOASA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|