C14H22OSi — CID 10857402
(1S,2R)-2-methyl-1-phenyl-3-trimethylsilylbut-3-en-1-ol (PubChem CID 10857402) has the molecular formula C14H22OSi and a molecular weight of 234.41 g/mol. Its IUPAC name is (1S,2R)-2-methyl-1-phenyl-3-trimethylsilylbut-3-en-1-ol.
| Compound Name | (1S,2R)-2-methyl-1-phenyl-3-trimethylsilylbut-3-en-1-ol |
|---|---|
| PubChem CID | 10857402 |
| Molecular Formula | C14H22OSi |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (1S,2R)-2-methyl-1-phenyl-3-trimethylsilylbut-3-en-1-ol |
| SMILES | C=C([C@H](C)[C@H](O)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C14H22OSi/c1-11(12(2)16(3,4)5)14(15)13-9-7-6-8-10-13/h6-11,14-15H,2H2,1,3-5H3/t11-,14-/m0/s1 |
| InChIKey | ADBRWOVPBOTIKY-FZMZJTMJSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|