C18H28Cl3OSiTi — CID 10478498
(E,1S,2R)-2-ethenyl-1-phenyl-7-trimethylsilylhept-5-en-1-ol;trichlorotitanium (PubChem CID 10478498) has the molecular formula C18H28Cl3OSiTi and a molecular weight of 442.73 g/mol. Its IUPAC name is (E,1S,2R)-2-ethenyl-1-phenyl-7-trimethylsilylhept-5-en-1-ol;trichlorotitanium.
| Compound Name | (E,1S,2R)-2-ethenyl-1-phenyl-7-trimethylsilylhept-5-en-1-ol;trichlorotitanium |
|---|---|
| PubChem CID | 10478498 |
| Molecular Formula | C18H28Cl3OSiTi |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | (E,1S,2R)-2-ethenyl-1-phenyl-7-trimethylsilylhept-5-en-1-ol;trichlorotitanium |
| SMILES | C=CC(CC/C=C/C[Si](C)(C)C)[C@H](O)c1ccccc1.Cl[Ti](Cl)Cl |
| InChI | InChI=1S/C18H28OSi.3ClH.Ti/c1-5-16(12-10-7-11-15-20(2,3)4)18(19)17-13-8-6-9-14-17;;;;/h5-9,11,13-14,16,18-19H,1,10,12,15H2,2-4H3;3*1H;/q;;;;+3/p-3/b11-7+;;;;/t16?,18-;;;;/m0..../s1 |
| InChIKey | WKKWWGQLTYYYNZ-RZJUARGOSA-K |
| XLogP | 7.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|