C18H26OSi — CID 11335171
(4S,5R,6E)-4-methyl-5-phenyl-8-trimethylsilylocta-1,6-dien-3-one (PubChem CID 11335171) has the molecular formula C18H26OSi and a molecular weight of 286.49 g/mol. Its IUPAC name is (4S,5R,6E)-4-methyl-5-phenyl-8-trimethylsilylocta-1,6-dien-3-one.
| Compound Name | (4S,5R,6E)-4-methyl-5-phenyl-8-trimethylsilylocta-1,6-dien-3-one |
|---|---|
| PubChem CID | 11335171 |
| Molecular Formula | C18H26OSi |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (4S,5R,6E)-4-methyl-5-phenyl-8-trimethylsilylocta-1,6-dien-3-one |
| SMILES | C=CC(=O)[C@@H](C)[C@@H](/C=C/C[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H26OSi/c1-6-18(19)15(2)17(13-10-14-20(3,4)5)16-11-8-7-9-12-16/h6-13,15,17H,1,14H2,2-5H3/b13-10+/t15-,17+/m0/s1 |
| InChIKey | OGLVHGHFUBTCHA-UJDGICINSA-N |
| XLogP | 5.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|