C19H30OSi — CID 11335668
(5S,6R,7E)-5-methyl-6-phenyl-9-trimethylsilylnona-1,7-dien-4-ol (PubChem CID 11335668) has the molecular formula C19H30OSi and a molecular weight of 302.53 g/mol. Its IUPAC name is (5S,6R,7E)-5-methyl-6-phenyl-9-trimethylsilylnona-1,7-dien-4-ol.
| Compound Name | (5S,6R,7E)-5-methyl-6-phenyl-9-trimethylsilylnona-1,7-dien-4-ol |
|---|---|
| PubChem CID | 11335668 |
| Molecular Formula | C19H30OSi |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (5S,6R,7E)-5-methyl-6-phenyl-9-trimethylsilylnona-1,7-dien-4-ol |
| SMILES | C=CCC(O)[C@@H](C)[C@@H](/C=C/C[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H30OSi/c1-6-11-19(20)16(2)18(14-10-15-21(3,4)5)17-12-8-7-9-13-17/h6-10,12-14,16,18-20H,1,11,15H2,2-5H3/b14-10+/t16-,18+,19?/m0/s1 |
| InChIKey | PBUTXXCYNGCSCF-AFPOMNJPSA-N |
| XLogP | 5.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|