C12H16OS — CID 10679903
(2R,3S)-2-phenylsulfanylhex-5-en-3-ol (PubChem CID 10679903) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is (2R,3S)-2-phenylsulfanylhex-5-en-3-ol.
| Compound Name | (2R,3S)-2-phenylsulfanylhex-5-en-3-ol |
|---|---|
| PubChem CID | 10679903 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (2R,3S)-2-phenylsulfanylhex-5-en-3-ol |
| SMILES | C=CC[C@H](O)[C@@H](C)Sc1ccccc1 |
| InChI | InChI=1S/C12H16OS/c1-3-7-12(13)10(2)14-11-8-5-4-6-9-11/h3-6,8-10,12-13H,1,7H2,2H3/t10-,12+/m1/s1 |
| InChIKey | DLVWPECSYGYRNU-PWSUYJOCSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|