C11H12Cl2FN — CID 102322180
2,2-dichloro-2-fluoro-1-phenyl-N-propan-2-ylethanimine (PubChem CID 102322180) has the molecular formula C11H12Cl2FN and a molecular weight of 248.13 g/mol. Its IUPAC name is 2,2-dichloro-2-fluoro-1-phenyl-N-propan-2-ylethanimine.
| Compound Name | 2,2-dichloro-2-fluoro-1-phenyl-N-propan-2-ylethanimine |
|---|---|
| PubChem CID | 102322180 |
| Molecular Formula | C11H12Cl2FN |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 2,2-dichloro-2-fluoro-1-phenyl-N-propan-2-ylethanimine |
| SMILES | CC(C)/N=C(\c1ccccc1)C(F)(Cl)Cl |
| InChI | InChI=1S/C11H12Cl2FN/c1-8(2)15-10(11(12,13)14)9-6-4-3-5-7-9/h3-8H,1-2H3/b15-10+ |
| InChIKey | MOHNWVGDCOUULO-XNTDXEJSSA-N |
| XLogP | 3.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|