C19H21Cl2NO3S — CID 10525822
(2,2-dichloro-1,3-diphenyl-3-propan-2-yliminopropyl) methanesulfonate (PubChem CID 10525822) has the molecular formula C19H21Cl2NO3S and a molecular weight of 414.35 g/mol. Its IUPAC name is (2,2-dichloro-1,3-diphenyl-3-propan-2-yliminopropyl) methanesulfonate.
| Compound Name | (2,2-dichloro-1,3-diphenyl-3-propan-2-yliminopropyl) methanesulfonate |
|---|---|
| PubChem CID | 10525822 |
| Molecular Formula | C19H21Cl2NO3S |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | (2,2-dichloro-1,3-diphenyl-3-propan-2-yliminopropyl) methanesulfonate |
| SMILES | CC(C)/N=C(\c1ccccc1)C(Cl)(Cl)C(OS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C19H21Cl2NO3S/c1-14(2)22-17(15-10-6-4-7-11-15)19(20,21)18(25-26(3,23)24)16-12-8-5-9-13-16/h4-14,18H,1-3H3/b22-17+ |
| InChIKey | XFYCGQHANPLJSY-OQKWZONESA-N |
| XLogP | 4.78 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|