C15H17NO3S — CID 101113765
[(1S,2S)-2-amino-1,2-diphenylethyl] methanesulfonate (PubChem CID 101113765) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is [(1S,2S)-2-amino-1,2-diphenylethyl] methanesulfonate.
| Compound Name | [(1S,2S)-2-amino-1,2-diphenylethyl] methanesulfonate |
|---|---|
| PubChem CID | 101113765 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | [(1S,2S)-2-amino-1,2-diphenylethyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H](c1ccccc1)[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C15H17NO3S/c1-20(17,18)19-15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12/h2-11,14-15H,16H2,1H3/t14-,15-/m0/s1 |
| InChIKey | OZPYZTMTDRTDKZ-GJZGRUSLSA-N |
| XLogP | 2.40 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|