C15H17NO2S — CID 55112040
2-methylsulfonyl-1,2-diphenylethanamine (PubChem CID 55112040) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-methylsulfonyl-1,2-diphenylethanamine.
| Compound Name | 2-methylsulfonyl-1,2-diphenylethanamine |
|---|---|
| PubChem CID | 55112040 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-methylsulfonyl-1,2-diphenylethanamine |
| SMILES | CS(=O)(=O)C(c1ccccc1)C(N)c1ccccc1 |
| InChI | InChI=1S/C15H17NO2S/c1-19(17,18)15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12/h2-11,14-15H,16H2,1H3 |
| InChIKey | SJTFQDOISANBHP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |