C18H24N2O4S2 — CID 92524263
(1R,2S)-N,N,N',N'-tetramethyl-1,2-diphenylethane-1,2-disulfonamide (PubChem CID 92524263) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is (1R,2S)-N,N,N',N'-tetramethyl-1,2-diphenylethane-1,2-disulfonamide.
| Compound Name | (1R,2S)-N,N,N',N'-tetramethyl-1,2-diphenylethane-1,2-disulfonamide |
|---|---|
| PubChem CID | 92524263 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (1R,2S)-N,N,N',N'-tetramethyl-1,2-diphenylethane-1,2-disulfonamide |
| SMILES | CN(C)S(=O)(=O)[C@H](c1ccccc1)[C@H](c1ccccc1)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C18H24N2O4S2/c1-19(2)25(21,22)17(15-11-7-5-8-12-15)18(26(23,24)20(3)4)16-13-9-6-10-14-16/h5-14,17-18H,1-4H3/t17-,18+ |
| InChIKey | DALYXFSTQTWNEA-HDICACEKSA-N |
| XLogP | 2.25 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |