C21H22N2O2S — CID 132939131
(1S,2S)-N'-(2-methylsulfonylphenyl)-1,2-diphenylethane-1,2-diamine (PubChem CID 132939131) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is (1S,2S)-N'-(2-methylsulfonylphenyl)-1,2-diphenylethane-1,2-diamine.
| Compound Name | (1S,2S)-N'-(2-methylsulfonylphenyl)-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 132939131 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (1S,2S)-N'-(2-methylsulfonylphenyl)-1,2-diphenylethane-1,2-diamine |
| SMILES | CS(=O)(=O)c1ccccc1N[C@@H](c1ccccc1)[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-26(24,25)19-15-9-8-14-18(19)23-21(17-12-6-3-7-13-17)20(22)16-10-4-2-5-11-16/h2-15,20-21,23H,22H2,1H3/t20-,21-/m0/s1 |
| InChIKey | LRLGTQZWUIGCTR-SFTDATJTSA-N |
| XLogP | 3.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |