C10H9ClF3N — CID 10966483
2,2,2-trifluoro-N-[(1R)-1-phenylethyl]ethanimidoyl chloride (PubChem CID 10966483) has the molecular formula C10H9ClF3N and a molecular weight of 235.64 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R)-1-phenylethyl]ethanimidoyl chloride.
| Compound Name | 2,2,2-trifluoro-N-[(1R)-1-phenylethyl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 10966483 |
| Molecular Formula | C10H9ClF3N |
| Molecular Weight | 235.64 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R)-1-phenylethyl]ethanimidoyl chloride |
| SMILES | C[C@@H](/N=C(\Cl)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H9ClF3N/c1-7(8-5-3-2-4-6-8)15-9(11)10(12,13)14/h2-7H,1H3/b15-9-/t7-/m1/s1 |
| InChIKey | AFNJDWIJDCSFCX-AQBZHZHDSA-N |
| XLogP | 3.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.64 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|