C25H29N3 — CID 101384426
1,2,3-tris[(1S)-1-phenylethyl]guanidine (PubChem CID 101384426) has the molecular formula C25H29N3 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1,2,3-tris[(1S)-1-phenylethyl]guanidine.
| Compound Name | 1,2,3-tris[(1S)-1-phenylethyl]guanidine |
|---|---|
| PubChem CID | 101384426 |
| Molecular Formula | C25H29N3 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 1,2,3-tris[(1S)-1-phenylethyl]guanidine |
| SMILES | C[C@H](N=C(N[C@@H](C)c1ccccc1)N[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29N3/c1-19(22-13-7-4-8-14-22)26-25(27-20(2)23-15-9-5-10-16-23)28-21(3)24-17-11-6-12-18-24/h4-21H,1-3H3,(H2,26,27,28)/t19-,20-,21-/m0/s1 |
| InChIKey | NGPWUAVHEHDZOA-ACRUOGEOSA-N |
| XLogP | 5.81 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|