C26H31N3O — CID 10811065
1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-2,3-bis[(1S)-1-phenylethyl]guanidine (PubChem CID 10811065) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-2,3-bis[(1S)-1-phenylethyl]guanidine.
| Compound Name | 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-2,3-bis[(1S)-1-phenylethyl]guanidine |
|---|---|
| PubChem CID | 10811065 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-2,3-bis[(1S)-1-phenylethyl]guanidine |
| SMILES | C[C@H](/N=C(\N[C@H](CO)Cc1ccccc1)N[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31N3O/c1-20(23-14-8-4-9-15-23)27-26(28-21(2)24-16-10-5-11-17-24)29-25(19-30)18-22-12-6-3-7-13-22/h3-17,20-21,25,30H,18-19H2,1-2H3,(H2,27,28,29)/t20-,21-,25-/m0/s1 |
| InChIKey | IKUAFPHCBXXVNP-WATLYSKOSA-N |
| XLogP | 4.65 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|