C10H15N5 — CID 54410144
1-(diaminomethylidene)-2-[(1S)-1-phenylethyl]guanidine (PubChem CID 54410144) has the molecular formula C10H15N5 and a molecular weight of 205.27 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[(1S)-1-phenylethyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[(1S)-1-phenylethyl]guanidine |
|---|---|
| PubChem CID | 54410144 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-[(1S)-1-phenylethyl]guanidine |
| SMILES | C[C@H](/N=C(\N)N=C(N)N)c1ccccc1 |
| InChI | InChI=1S/C10H15N5/c1-7(8-5-3-2-4-6-8)14-10(13)15-9(11)12/h2-7H,1H3,(H6,11,12,13,14,15)/t7-/m0/s1 |
| InChIKey | VTNMRMWMJVVEPD-ZETCQYMHSA-N |
| XLogP | 0.34 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|