C12H19N5 — CID 24835754
1-(diaminomethylidene)-2-(1-phenylbutan-2-yl)guanidine (PubChem CID 24835754) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(1-phenylbutan-2-yl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(1-phenylbutan-2-yl)guanidine |
|---|---|
| PubChem CID | 24835754 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-(diaminomethylidene)-2-(1-phenylbutan-2-yl)guanidine |
| SMILES | CCC(Cc1ccccc1)/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C12H19N5/c1-2-10(16-12(15)17-11(13)14)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H6,13,14,15,16,17) |
| InChIKey | LILAYUQAVRMSFD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|