C17H19N3O — CID 90027611
(2R,3R)-N-(diaminomethylidene)-2,3-diphenylbutanamide (PubChem CID 90027611) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is (2R,3R)-N-(diaminomethylidene)-2,3-diphenylbutanamide.
| Compound Name | (2R,3R)-N-(diaminomethylidene)-2,3-diphenylbutanamide |
|---|---|
| PubChem CID | 90027611 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (2R,3R)-N-(diaminomethylidene)-2,3-diphenylbutanamide |
| SMILES | C[C@@H](c1ccccc1)[C@@H](C(=O)N=C(N)N)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O/c1-12(13-8-4-2-5-9-13)15(16(21)20-17(18)19)14-10-6-3-7-11-14/h2-12,15H,1H3,(H4,18,19,20,21)/t12-,15+/m0/s1 |
| InChIKey | SKKSBTGKROCWDQ-SWLSCSKDSA-N |
| XLogP | 2.37 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|