C15H17Cl2N5 — CID 90034255
2-[(4-chlorophenyl)-phenylmethyl]-1-(diaminomethylidene)guanidine;hydrochloride (PubChem CID 90034255) has the molecular formula C15H17Cl2N5 and a molecular weight of 338.24 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)-phenylmethyl]-1-(diaminomethylidene)guanidine;hydrochloride.
| Compound Name | 2-[(4-chlorophenyl)-phenylmethyl]-1-(diaminomethylidene)guanidine;hydrochloride |
|---|---|
| PubChem CID | 90034255 |
| Molecular Formula | C15H17Cl2N5 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-[(4-chlorophenyl)-phenylmethyl]-1-(diaminomethylidene)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/C(N)=N\C(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN5.ClH/c16-12-8-6-11(7-9-12)13(10-4-2-1-3-5-10)20-15(19)21-14(17)18;/h1-9,13H,(H6,17,18,19,20,21);1H |
| InChIKey | SEBIKTIVIXBRNQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|