C8H12Cl2N6 — CID 175205005
2-(4-chloroanilino)-1-(diaminomethylidene)guanidine;hydrochloride (PubChem CID 175205005) has the molecular formula C8H12Cl2N6 and a molecular weight of 263.13 g/mol. Its IUPAC name is 2-(4-chloroanilino)-1-(diaminomethylidene)guanidine;hydrochloride.
| Compound Name | 2-(4-chloroanilino)-1-(diaminomethylidene)guanidine;hydrochloride |
|---|---|
| PubChem CID | 175205005 |
| Molecular Formula | C8H12Cl2N6 |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-(4-chloroanilino)-1-(diaminomethylidene)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=NC(N)=NNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H11ClN6.ClH/c9-5-1-3-6(4-2-5)14-15-8(12)13-7(10)11;/h1-4,14H,(H6,10,11,12,13,15);1H |
| InChIKey | TVAMQBUENNFJCW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|