C9H7ClN4O — CID 2814561
2-amino-N-(4-chloroanilino)-2-oxoethanimidoyl cyanide (PubChem CID 2814561) has the molecular formula C9H7ClN4O and a molecular weight of 222.64 g/mol. Its IUPAC name is 2-amino-N-(4-chloroanilino)-2-oxoethanimidoyl cyanide.
| Compound Name | 2-amino-N-(4-chloroanilino)-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 2814561 |
| Molecular Formula | C9H7ClN4O |
| Molecular Weight | 222.64 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 2-amino-N-(4-chloroanilino)-2-oxoethanimidoyl cyanide |
| SMILES | N#CC(=NNc1ccc(Cl)cc1)C(N)=O |
| InChI | InChI=1S/C9H7ClN4O/c10-6-1-3-7(4-2-6)13-14-8(5-11)9(12)15/h1-4,13H,(H2,12,15) |
| InChIKey | WYWQKJMVDSLNCU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.64 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|