C15H21ClN5+ — CID 3457445
[1-amino-2-[(4-chlorophenyl)hydrazinylidene]-2-cyanoethylidene]-dipropylazanium (PubChem CID 3457445) has the molecular formula C15H21ClN5+ and a molecular weight of 306.82 g/mol. Its IUPAC name is [1-amino-2-[(4-chlorophenyl)hydrazinylidene]-2-cyanoethylidene]-dipropylazanium.
| Compound Name | [1-amino-2-[(4-chlorophenyl)hydrazinylidene]-2-cyanoethylidene]-dipropylazanium |
|---|---|
| PubChem CID | 3457445 |
| Molecular Formula | C15H21ClN5+ |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [1-amino-2-[(4-chlorophenyl)hydrazinylidene]-2-cyanoethylidene]-dipropylazanium |
| SMILES | CCC[N+](CCC)=C(N)C(C#N)=NNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClN5/c1-3-9-21(10-4-2)15(18)14(11-17)20-19-13-7-5-12(16)6-8-13/h5-8H,3-4,9-10H2,1-2H3,(H2,18,19)/p+1 |
| InChIKey | DXDZWWUAXJDGGT-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|