C21H21F6N — CID 140515637
1-[3,5-bis(trifluoromethyl)phenyl]-N-(1-phenylethyl)pentan-1-imine (PubChem CID 140515637) has the molecular formula C21H21F6N and a molecular weight of 401.39 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-N-(1-phenylethyl)pentan-1-imine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-(1-phenylethyl)pentan-1-imine |
|---|---|
| PubChem CID | 140515637 |
| Molecular Formula | C21H21F6N |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-(1-phenylethyl)pentan-1-imine |
| SMILES | CCCC/C(=N\C(C)c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F6N/c1-3-4-10-19(28-14(2)15-8-6-5-7-9-15)16-11-17(20(22,23)24)13-18(12-16)21(25,26)27/h5-9,11-14H,3-4,10H2,1-2H3/b28-19+ |
| InChIKey | YXOPGLOUOWCPFI-TURZUDJPSA-N |
| XLogP | 7.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|