C16H24N2O — CID 11436890
N,N,3,3-tetramethyl-2-[(1S)-1-phenylethyl]iminobutanamide (PubChem CID 11436890) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N,N,3,3-tetramethyl-2-[(1S)-1-phenylethyl]iminobutanamide.
| Compound Name | N,N,3,3-tetramethyl-2-[(1S)-1-phenylethyl]iminobutanamide |
|---|---|
| PubChem CID | 11436890 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N,N,3,3-tetramethyl-2-[(1S)-1-phenylethyl]iminobutanamide |
| SMILES | C[C@H](/N=C(\C(=O)N(C)C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O/c1-12(13-10-8-7-9-11-13)17-14(16(2,3)4)15(19)18(5)6/h7-12H,1-6H3/b17-14+/t12-/m0/s1 |
| InChIKey | UOROMFUTXFAHDU-KNEMVRMJSA-N |
| XLogP | 3.32 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|