C25H34O3 — CID 141291359
4,6-dihydroxy-2,4,6,8-tetramethyl-3,7-diphenylnonan-5-one (PubChem CID 141291359) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is 4,6-dihydroxy-2,4,6,8-tetramethyl-3,7-diphenylnonan-5-one.
| Compound Name | 4,6-dihydroxy-2,4,6,8-tetramethyl-3,7-diphenylnonan-5-one |
|---|---|
| PubChem CID | 141291359 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 4,6-dihydroxy-2,4,6,8-tetramethyl-3,7-diphenylnonan-5-one |
| SMILES | CC(C)C(c1ccccc1)C(C)(O)C(=O)C(C)(O)C(c1ccccc1)C(C)C |
| InChI | InChI=1S/C25H34O3/c1-17(2)21(19-13-9-7-10-14-19)24(5,27)23(26)25(6,28)22(18(3)4)20-15-11-8-12-16-20/h7-18,21-22,27-28H,1-6H3 |
| InChIKey | YZAPMTLMDAPPMW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |