C18H20O3 — CID 79304394
2-hydroxy-2,3-dimethyl-4,4-diphenylbutanoic acid (PubChem CID 79304394) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-hydroxy-2,3-dimethyl-4,4-diphenylbutanoic acid.
| Compound Name | 2-hydroxy-2,3-dimethyl-4,4-diphenylbutanoic acid |
|---|---|
| PubChem CID | 79304394 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-hydroxy-2,3-dimethyl-4,4-diphenylbutanoic acid |
| SMILES | CC(C(c1ccccc1)c1ccccc1)C(C)(O)C(=O)O |
| InChI | InChI=1S/C18H20O3/c1-13(18(2,21)17(19)20)16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16,21H,1-2H3,(H,19,20) |
| InChIKey | OCPWRNHGFXXFEL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |