C17H28 — CID 123822213
2,2,4,5,5-pentamethylhexan-3-ylbenzene (PubChem CID 123822213) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 2,2,4,5,5-pentamethylhexan-3-ylbenzene.
| Compound Name | 2,2,4,5,5-pentamethylhexan-3-ylbenzene |
|---|---|
| PubChem CID | 123822213 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 2,2,4,5,5-pentamethylhexan-3-ylbenzene |
| SMILES | CC(C(c1ccccc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H28/c1-13(16(2,3)4)15(17(5,6)7)14-11-9-8-10-12-14/h8-13,15H,1-7H3 |
| InChIKey | VRBVQIMTKSWKLW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |