C15H16N2O3 — CID 141292238
(2-oxo-1-phenyl-2-pyrrol-1-ylethyl) N,N-dimethylcarbamate (PubChem CID 141292238) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2-oxo-1-phenyl-2-pyrrol-1-ylethyl) N,N-dimethylcarbamate.
| Compound Name | (2-oxo-1-phenyl-2-pyrrol-1-ylethyl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 141292238 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (2-oxo-1-phenyl-2-pyrrol-1-ylethyl) N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OC(C(=O)n1cccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O3/c1-16(2)15(19)20-13(12-8-4-3-5-9-12)14(18)17-10-6-7-11-17/h3-11,13H,1-2H3 |
| InChIKey | FCEFKZPUMPWBCF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |