C12H12F4O — CID 10729195
[(E)-1,3,3,3-tetrafluoro-1-propan-2-yloxyprop-1-en-2-yl]benzene (PubChem CID 10729195) has the molecular formula C12H12F4O and a molecular weight of 248.22 g/mol. Its IUPAC name is [(E)-1,3,3,3-tetrafluoro-1-propan-2-yloxyprop-1-en-2-yl]benzene.
| Compound Name | [(E)-1,3,3,3-tetrafluoro-1-propan-2-yloxyprop-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 10729195 |
| Molecular Formula | C12H12F4O |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | [(E)-1,3,3,3-tetrafluoro-1-propan-2-yloxyprop-1-en-2-yl]benzene |
| SMILES | CC(C)O/C(F)=C(/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F4O/c1-8(2)17-11(13)10(12(14,15)16)9-6-4-3-5-7-9/h3-8H,1-2H3/b11-10- |
| InChIKey | NIVYUMJFVOIGSI-KHPPLWFESA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|