C10H5BrF3N — CID 15142419
(E)-2-bromo-4,4,4-trifluoro-3-phenylbut-2-enenitrile (PubChem CID 15142419) has the molecular formula C10H5BrF3N and a molecular weight of 276.06 g/mol. Its IUPAC name is (E)-2-bromo-4,4,4-trifluoro-3-phenylbut-2-enenitrile.
| Compound Name | (E)-2-bromo-4,4,4-trifluoro-3-phenylbut-2-enenitrile |
|---|---|
| PubChem CID | 15142419 |
| Molecular Formula | C10H5BrF3N |
| Molecular Weight | 276.06 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | (E)-2-bromo-4,4,4-trifluoro-3-phenylbut-2-enenitrile |
| SMILES | N#C/C(Br)=C(/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H5BrF3N/c11-8(6-15)9(10(12,13)14)7-4-2-1-3-5-7/h1-5H/b9-8+ |
| InChIKey | ZQLDKUICHQAEOP-CMDGGOBGSA-N |
| XLogP | 3.88 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.06 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|