C21H14F4 — CID 102466586
1-fluoro-3-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]benzene (PubChem CID 102466586) has the molecular formula C21H14F4 and a molecular weight of 342.34 g/mol. Its IUPAC name is 1-fluoro-3-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]benzene.
| Compound Name | 1-fluoro-3-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]benzene |
|---|---|
| PubChem CID | 102466586 |
| Molecular Formula | C21H14F4 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-fluoro-3-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]benzene |
| SMILES | Fc1cccc(/C(=C(\c2ccccc2)C(F)(F)F)c2ccccc2)c1 |
| InChI | InChI=1S/C21H14F4/c22-18-13-7-12-17(14-18)19(15-8-3-1-4-9-15)20(21(23,24)25)16-10-5-2-6-11-16/h1-14H/b20-19+ |
| InChIKey | BVIMYAVSJMKXID-FMQUCBEESA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|