C15H9F5O4 — CID 160578219
3-fluorobenzoic acid;3-fluoro-5-(trifluoromethyl)benzoic acid (PubChem CID 160578219) has the molecular formula C15H9F5O4 and a molecular weight of 348.22 g/mol. Its IUPAC name is 3-fluorobenzoic acid;3-fluoro-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-fluorobenzoic acid;3-fluoro-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 160578219 |
| Molecular Formula | C15H9F5O4 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-fluorobenzoic acid;3-fluoro-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(F)cc(C(F)(F)F)c1.O=C(O)c1cccc(F)c1 |
| InChI | InChI=1S/C8H4F4O2.C7H5FO2/c9-6-2-4(7(13)14)1-5(3-6)8(10,11)12;8-6-3-1-2-5(4-6)7(9)10/h1-3H,(H,13,14);1-4H,(H,9,10) |
| InChIKey | RBKVPNRYEIEFOH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |