C9H4Cl2F4O — CID 146008732
2,2-dichloro-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanone (PubChem CID 146008732) has the molecular formula C9H4Cl2F4O and a molecular weight of 275.03 g/mol. Its IUPAC name is 2,2-dichloro-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2,2-dichloro-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 146008732 |
| Molecular Formula | C9H4Cl2F4O |
| Molecular Weight | 275.03 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | 2,2-dichloro-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(c1cc(F)cc(C(F)(F)F)c1)C(Cl)Cl |
| InChI | InChI=1S/C9H4Cl2F4O/c10-8(11)7(16)4-1-5(9(13,14)15)3-6(12)2-4/h1-3,8H |
| InChIKey | VQVDCZDUYUFXQM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.03 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|