C11H7BrF6O — CID 90951928
(2R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-bromopropan-1-one (PubChem CID 90951928) has the molecular formula C11H7BrF6O and a molecular weight of 349.07 g/mol. Its IUPAC name is (2R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-bromopropan-1-one.
| Compound Name | (2R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-bromopropan-1-one |
|---|---|
| PubChem CID | 90951928 |
| Molecular Formula | C11H7BrF6O |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | (2R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-bromopropan-1-one |
| SMILES | C[C@@H](Br)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7BrF6O/c1-5(12)9(19)6-2-7(10(13,14)15)4-8(3-6)11(16,17)18/h2-5H,1H3/t5-/m1/s1 |
| InChIKey | SOVNNTVCMDQPII-RXMQYKEDSA-N |
| XLogP | 4.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|