C16H13F6NO2 — CID 165115664
2-[3,5-bis(trifluoromethyl)benzoyl]-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 165115664) has the molecular formula C16H13F6NO2 and a molecular weight of 365.27 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzoyl]-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzoyl]-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 165115664 |
| Molecular Formula | C16H13F6NO2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzoyl]-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | CC(C)(C)C(=O)C(C#N)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F6NO2/c1-14(2,3)13(25)11(7-23)12(24)8-4-9(15(17,18)19)6-10(5-8)16(20,21)22/h4-6,11H,1-3H3 |
| InChIKey | SVKAOHSEUSHSEL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|