C12H10F3NO2 — CID 138754907
3-(2-cyanopropan-2-yl)-5-(trifluoromethyl)benzoic acid (PubChem CID 138754907) has the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. Its IUPAC name is 3-(2-cyanopropan-2-yl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(2-cyanopropan-2-yl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 138754907 |
| Molecular Formula | C12H10F3NO2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-(2-cyanopropan-2-yl)-5-(trifluoromethyl)benzoic acid |
| SMILES | CC(C)(C#N)c1cc(C(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F3NO2/c1-11(2,6-16)8-3-7(10(17)18)4-9(5-8)12(13,14)15/h3-5H,1-2H3,(H,17,18) |
| InChIKey | BJQBGXOOKUFWEN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |