C13H12ClF6NO — CID 132849037
N-tert-butyl-N-chloro-3,5-bis(trifluoromethyl)benzamide (PubChem CID 132849037) has the molecular formula C13H12ClF6NO and a molecular weight of 347.69 g/mol. Its IUPAC name is N-tert-butyl-N-chloro-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-tert-butyl-N-chloro-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 132849037 |
| Molecular Formula | C13H12ClF6NO |
| Molecular Weight | 347.69 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-tert-butyl-N-chloro-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC(C)(C)N(Cl)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12ClF6NO/c1-11(2,3)21(14)10(22)7-4-8(12(15,16)17)6-9(5-7)13(18,19)20/h4-6H,1-3H3 |
| InChIKey | VIPRLZAEZGEWHH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|