C20H8F11NO2 — CID 167430164
2-[4-[3,5-bis(trifluoromethyl)phenyl]benzoyl]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile (PubChem CID 167430164) has the molecular formula C20H8F11NO2 and a molecular weight of 503.27 g/mol. Its IUPAC name is 2-[4-[3,5-bis(trifluoromethyl)phenyl]benzoyl]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile.
| Compound Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]benzoyl]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile |
|---|---|
| PubChem CID | 167430164 |
| Molecular Formula | C20H8F11NO2 |
| Molecular Weight | 503.27 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]benzoyl]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile |
| SMILES | N#CC(C(=O)c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H8F11NO2/c21-17(22,20(29,30)31)16(34)14(8-32)15(33)10-3-1-9(2-4-10)11-5-12(18(23,24)25)7-13(6-11)19(26,27)28/h1-7,14H |
| InChIKey | KQKWXHZHDPFFOX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.27 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|