C40H16CuF22N2O4 — CID 167430166
bis((2Z)-2-[[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxymethylidene]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile);copper (PubChem CID 167430166) has the molecular formula C40H16CuF22N2O4 and a molecular weight of 1070.08 g/mol. Its IUPAC name is bis((2Z)-2-[[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxymethylidene]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile);copper.
| Compound Name | bis((2Z)-2-[[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxymethylidene]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile);copper |
|---|---|
| PubChem CID | 167430166 |
| Molecular Formula | C40H16CuF22N2O4 |
| Molecular Weight | 1070.08 g/mol |
| Exact Mass | 1069.01 |
| IUPAC Name | bis((2Z)-2-[[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxymethylidene]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile);copper |
| SMILES | N#C/C(C(=O)C(F)(F)C(F)(F)F)=C(/O)c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1.N#C/C(C(=O)C(F)(F)C(F)(F)F)=C(/O)c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1.[Cu] |
| InChI | InChI=1S/2C20H8F11NO2.Cu/c2*21-17(22,20(29,30)31)16(34)14(8-32)15(33)10-3-1-9(2-4-10)11-5-12(18(23,24)25)7-13(6-11)19(26,27)28;/h2*1-7,33H;/b2*15-14-; |
| InChIKey | XXYSEIAENXXEIC-PFTAMHQLSA-N |
| XLogP | 13.90 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.08 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|