C15H7F6N — CID 11381476
4-[3,5-bis(trifluoromethyl)phenyl]benzonitrile (PubChem CID 11381476) has the molecular formula C15H7F6N and a molecular weight of 315.22 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 11381476 |
| Molecular Formula | C15H7F6N |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H7F6N/c16-14(17,18)12-5-11(6-13(7-12)15(19,20)21)10-3-1-9(8-22)2-4-10/h1-7H |
| InChIKey | NJDGZDKOONMNOC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |