C66H34F3N7 — CID 142502030
2,6-bis[2,7-bis(4-cyanophenyl)carbazol-9-yl]-4-[3-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 142502030) has the molecular formula C66H34F3N7 and a molecular weight of 982.04 g/mol. Its IUPAC name is 2,6-bis[2,7-bis(4-cyanophenyl)carbazol-9-yl]-4-[3-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,6-bis[2,7-bis(4-cyanophenyl)carbazol-9-yl]-4-[3-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 142502030 |
| Molecular Formula | C66H34F3N7 |
| Molecular Weight | 982.04 g/mol |
| Exact Mass | 981.28 |
| IUPAC Name | 2,6-bis[2,7-bis(4-cyanophenyl)carbazol-9-yl]-4-[3-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c4ccc(-c5ccc(C#N)cc5)cc4n(-c4cc(-c5cccc(C(F)(F)F)c5)cc(-n5c6cc(-c7ccc(C#N)cc7)ccc6c6ccc(-c7ccc(C#N)cc7)cc65)c4C#N)c3c2)cc1 |
| InChI | InChI=1S/C66H34F3N7/c67-66(68,69)54-3-1-2-48(28-54)53-33-64(75-60-29-49(44-12-4-40(35-70)5-13-44)20-24-55(60)56-25-21-50(30-61(56)75)45-14-6-41(36-71)7-15-45)59(39-74)65(34-53)76-62-31-51(46-16-8-42(37-72)9-17-46)22-26-57(62)58-27-23-52(32-63(58)76)47-18-10-43(38-73)11-19-47/h1-34H |
| InChIKey | OLEXGVWVZOKFLR-UHFFFAOYSA-N |
| XLogP | 16.59 |
| TPSA | 128.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.04 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |