C20H24NO+ — CID 10249248
4-(2,6-ditert-butylpyrylium-4-yl)benzonitrile (PubChem CID 10249248) has the molecular formula C20H24NO+ and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-(2,6-ditert-butylpyrylium-4-yl)benzonitrile.
| Compound Name | 4-(2,6-ditert-butylpyrylium-4-yl)benzonitrile |
|---|---|
| PubChem CID | 10249248 |
| Molecular Formula | C20H24NO+ |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 4-(2,6-ditert-butylpyrylium-4-yl)benzonitrile |
| SMILES | CC(C)(C)c1cc(-c2ccc(C#N)cc2)cc(C(C)(C)C)[o+]1 |
| InChI | InChI=1S/C20H24NO/c1-19(2,3)17-11-16(12-18(22-17)20(4,5)6)15-9-7-14(13-21)8-10-15/h7-12H,1-6H3/q+1 |
| InChIKey | YHDQTEAGLHATKB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 35.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|