C38H24N2 — CID 176994414
4-[4-[4-(4-cyanophenyl)phenyl]phenyl]-2,6-diphenylbenzonitrile (PubChem CID 176994414) has the molecular formula C38H24N2 and a molecular weight of 508.62 g/mol. Its IUPAC name is 4-[4-[4-(4-cyanophenyl)phenyl]phenyl]-2,6-diphenylbenzonitrile.
| Compound Name | 4-[4-[4-(4-cyanophenyl)phenyl]phenyl]-2,6-diphenylbenzonitrile |
|---|---|
| PubChem CID | 176994414 |
| Molecular Formula | C38H24N2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 4-[4-[4-(4-cyanophenyl)phenyl]phenyl]-2,6-diphenylbenzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3ccc(-c4cc(-c5ccccc5)c(C#N)c(-c5ccccc5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H24N2/c39-25-27-11-13-28(14-12-27)29-15-17-30(18-16-29)31-19-21-32(22-20-31)35-23-36(33-7-3-1-4-8-33)38(26-40)37(24-35)34-9-5-2-6-10-34/h1-24H |
| InChIKey | ZKCIRUTXQHYAJH-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |